Products 66637-86-3
CAS 66637-86-3 appears in our catalog under these names: 3-Phenoxymandelic acid, 98%, 3-Phenoxymandelic acid, 95%, 3-PHENOXYMANDELIC ACID, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-hydroxy-2-(3-phenoxyphenyl)acetic acid (CAS 66637-86-3) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-hydroxy-2-(3-phenoxyphenyl)acetic acid. InChIKey: FPUCYPXKIFVDSD-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-hydroxy-2-(3-phenoxyphenyl)acetic acid |
| InChIKey | FPUCYPXKIFVDSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(C(=O)O)O |
Computed by PubChem (NCBI)