cas: 2176-45-6 — see every product listed under this CAS number, including other names
3-Phenoxypyridine 98% (CAS 2176-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119484-100mg |
| cas | 2176-45-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A119484 |
3-phenoxypyridine (CAS 2176-45-6) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 3-phenoxypyridine. InChIKey: KDGUIKPOZGYLQJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 3-phenoxypyridine |
| InChIKey | KDGUIKPOZGYLQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CN=CC=C2 |
Computed by PubChem (NCBI)