3-amino-6-chloro-5-ethoxy-pyridine-2-carboxylic acid, 97%
cas: 1352907-85-7 — see every product listed under this CAS number, including other names
3-amino-6-chloro-5-ethoxy-pyridine-2-carboxylic acid, 97% (CAS 1352907-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1333O0-100mg |
| cas | 1352907-85-7 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 918.80 Pln | |
| Chemat | 250mg | 1432.40 Pln | |
| Chemat | 500mg | 2330.00 Pln | |
| Chemat | 1g | 3491.60 Pln | |
| Chemat | 5g | 10701.20 Pln | |
| Chemat | 10g | 17829.20 Pln | |
| Fluorochem | 100mg | 1695.25 Pln | |
| Fluorochem | 250mg | 2663.66 Pln | |
| Fluorochem | 500mg | 4308.92 Pln | |
| Fluorochem | 1g | 6355.07 Pln | |
| Fluorochem | 5g | 19543.14 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-amino-6-chloro-5-ethoxypyridine-2-carboxylic acid (CAS 1352907-85-7) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 3-amino-6-chloro-5-ethoxypyridine-2-carboxylic acid. InChIKey: FEZWFYWSDXLION-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 3-amino-6-chloro-5-ethoxypyridine-2-carboxylic acid |
| InChIKey | FEZWFYWSDXLION-UHFFFAOYSA-N |
| SMILES | CCOC1=C(N=C(C(=C1)N)C(=O)O)Cl |
Computed by PubChem (NCBI)