cas: 6665-67-4 — see every product listed under this CAS number, including other names
4',5–Dihydroxyflavone (CAS 6665-67-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC30277-10 |
| cas | 6665-67-4 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 592.36 Pln | |
| GLPBio | 25mg | 770.22 Pln | |
| GLPBio | 5mg | 526.83 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 540.87 Pln | |
| GLPBio | 50mg | 980.84 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 6665-67-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: OKRNDQLCMXUCGG-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | OKRNDQLCMXUCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)