cas: 6665-67-4 — see every product listed under this CAS number, including other names
4',5-Dihydroxyflavone, 99.95% (CAS 6665-67-4) is a chemical reagent available from Chemat. Available pack sizes: 10 mg, 50 mg, 10mM/1mL, 25 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N1881-10 mg |
| cas | 6665-67-4 |
| size | 10 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 mg | 454.37 Pln | |
| MedChemExpress | 50 mg | 1192.76 Pln | |
| MedChemExpress | 10mM/1mL | 361.49 Pln | |
| MedChemExpress | 25 mg | 793.38 Pln | |
| MedChemExpress | 5 mg | 333.62 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 6665-67-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: OKRNDQLCMXUCGG-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | OKRNDQLCMXUCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)