4'-Amino-2,2':6',2''-terpyridine, 98%
cas: 193944-66-0 — see every product listed under this CAS number, including other names
4'-Amino-2,2':6',2''-terpyridine, 98% (CAS 193944-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691084-100MG |
| cas | 193944-66-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 409.25 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1690.05 Pln | |
| Fluorochem | 5g | 6297.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dipyridin-2-ylpyridin-4-amine (CAS 193944-66-0) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: 2,6-dipyridin-2-ylpyridin-4-amine. InChIKey: ROISIAUYBSOVRR-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 2,6-dipyridin-2-ylpyridin-4-amine |
| InChIKey | ROISIAUYBSOVRR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)N |
Computed by PubChem (NCBI)