CAS 153467-49-3 appears in our catalog under these names: Tri(pyridin–3–yl)amine, Tri(pyridin-3-yl)amine 98%, Tri(pyridin-3-yl)amine, 98%, Tri(pyridin-3-yl)amine, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
N,N-dipyridin-3-ylpyridin-3-amine (CAS 153467-49-3) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: N,N-dipyridin-3-ylpyridin-3-amine. InChIKey: PSUXVBSSAMBTKS-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | N,N-dipyridin-3-ylpyridin-3-amine |
| InChIKey | PSUXVBSSAMBTKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)N(C2=CN=CC=C2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)