CAS 5999-14-4 is the registry number for 2-(1H-1,3-Benzodiazol-2-ylmethyl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(1H-benzimidazol-2-ylmethyl)-1H-benzimidazole (CAS 5999-14-4) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: 2-(1H-benzimidazol-2-ylmethyl)-1H-benzimidazole. InChIKey: VPJBLVPIUUNPLB-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-ylmethyl)-1H-benzimidazole |
| InChIKey | VPJBLVPIUUNPLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)