CAS 124337-33-3 is the registry number for 1-((1H-Indol-1-yl)methyl)-1H-benzo(d)(1,2,3)triazole, 98%. Offered by: AmBeed. Available pack sizes: 50mg.
1-(indol-1-ylmethyl)benzotriazole (CAS 124337-33-3) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: 1-(indol-1-ylmethyl)benzotriazole. InChIKey: CHXGJWXOGQXSBS-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-(indol-1-ylmethyl)benzotriazole |
| InChIKey | CHXGJWXOGQXSBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2CN3C4=CC=CC=C4N=N3 |
Computed by PubChem (NCBI)