CAS 2373417-03-7 appears in our catalog under these names: 5-Phenyl-3-(pyridin-4-yl)pyrazin-2-amine, 98%, 5-Phenyl-3-(pyridin-4-yl)pyrazin-2-amine, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-phenyl-3-pyridin-4-ylpyrazin-2-amine (CAS 2373417-03-7) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: 5-phenyl-3-pyridin-4-ylpyrazin-2-amine. InChIKey: ZBXBUBRRDABCKL-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 5-phenyl-3-pyridin-4-ylpyrazin-2-amine |
| InChIKey | ZBXBUBRRDABCKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C(=N2)C3=CC=NC=C3)N |
Computed by PubChem (NCBI)