CAS 5418-07-5 appears in our catalog under these names: 4,6–Diphenyl–1,3,5–triazin–2–amine, 4,6-Diphenyl-1,3,5-triazin-2-amine 98%, 4,6-Diphenyl-1,3,5-triazin-2-amine, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,6-diphenyl-1,3,5-triazin-2-amine (CAS 5418-07-5) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: 4,6-diphenyl-1,3,5-triazin-2-amine. InChIKey: HWLRYMYJGAGIME-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 4,6-diphenyl-1,3,5-triazin-2-amine |
| InChIKey | HWLRYMYJGAGIME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)