4'-Bromo-[1,1'-biphenyl]-4-ol, 97%
cas: 29558-77-8 — see every product listed under this CAS number, including other names
4'-Bromo-[1,1'-biphenyl]-4-ol, 97% (CAS 29558-77-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A100652-5g |
| cas | 29558-77-8 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 442.69 Pln | |
| Ambeed | 500g | 1538.50 Pln | |
| Ambeed | 1kg | 2840.12 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 158.86 Pln | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 469.86 Pln | |
| BLDpharm | 500g | 1652.78 Pln | |
| BLDpharm | 1kg | 3035.62 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-bromophenyl)phenol (CAS 29558-77-8) is a chemical compound with the molecular formula C12H9BrO and a molecular weight of 249.10 g/mol. IUPAC name: 4-(4-bromophenyl)phenol. InChIKey: ARUBXNBYMCVENE-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 4-(4-bromophenyl)phenol |
| InChIKey | ARUBXNBYMCVENE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)
