Products 58149-87-4
CAS 58149-87-4 is the registry number for 1-(5-Bromonaphthalen-1-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-bromonaphthalen-1-yl)ethanone (CAS 58149-87-4) is a chemical compound with the molecular formula C12H9BrO and a molecular weight of 249.10 g/mol. IUPAC name: 1-(5-bromonaphthalen-1-yl)ethanone. InChIKey: CKVLRTAJCSSPCT-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 1-(5-bromonaphthalen-1-yl)ethanone |
| InChIKey | CKVLRTAJCSSPCT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)