CAS 1590-25-6 appears in our catalog under these names: 1–(6–Bromonaphthalen–2–yl)ethanone, 1-(6-Bromonaphthalen-2-yl)ethanone 97%, 1-(6-Bromonaphthalen-2-yl)ethanone, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 10g.
1-(6-bromonaphthalen-2-yl)ethanone (CAS 1590-25-6) is a chemical compound with the molecular formula C12H9BrO and a molecular weight of 249.10 g/mol. IUPAC name: 1-(6-bromonaphthalen-2-yl)ethanone. InChIKey: UZDOTHVVSQOCJO-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 1-(6-bromonaphthalen-2-yl)ethanone |
| InChIKey | UZDOTHVVSQOCJO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)