CAS 21849-89-8 appears in our catalog under these names: 4'-Bromo-(1,1'-biphenyl)-2-ol, 95-<97%, 4'-Bromo-(1,1'-biphenyl)-2-ol, 95%, 4'–Bromo–(1,1'–biphenyl)–2–ol. Offered by: Hoffman Fine Chemicals, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 250mg.
2-(4-bromophenyl)phenol (CAS 21849-89-8) is a chemical compound with the molecular formula C12H9BrO and a molecular weight of 249.10 g/mol. IUPAC name: 2-(4-bromophenyl)phenol. InChIKey: ZGOWIHIGUHWAMQ-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)phenol |
| InChIKey | ZGOWIHIGUHWAMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)