CAS 136649-31-5 appears in our catalog under these names: 3-Bromo-5-phenylphenol, 95%, 3-Bromo-5-phenylphenol, 95%, 95%, 5-Bromo-[1,1'-biphenyl]-3-ol 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 25mg, 50mg, 100mg.
3-bromo-5-phenylphenol (CAS 136649-31-5) is a chemical compound with the molecular formula C12H9BrO and a molecular weight of 249.10 g/mol. IUPAC name: 3-bromo-5-phenylphenol. InChIKey: JCQWHMKUEMXGQC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 3-bromo-5-phenylphenol |
| InChIKey | JCQWHMKUEMXGQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Br)O |
Computed by PubChem (NCBI)