CAS 15460-07-8 is the registry number for 2-Bromo-[1,1'-biphenyl]-4-ol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-4-phenylphenol (CAS 15460-07-8) is a chemical compound with the molecular formula C12H9BrO and a molecular weight of 249.10 g/mol. IUPAC name: 3-bromo-4-phenylphenol. InChIKey: ILUQRRFVXAIYHN-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | 3-bromo-4-phenylphenol |
| InChIKey | ILUQRRFVXAIYHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)O)Br |
Computed by PubChem (NCBI)