CAS 886370-99-6 is the registry number for 4'-Chloro-2'-fluoro-2,2,2-trifluoroacetophenone, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone (CAS 886370-99-6) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: IKAPDKROUMAHCC-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | IKAPDKROUMAHCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)