CAS 151135-64-7 appears in our catalog under these names: 4'–Hydroxy–2,4–dimethoxychalcone, 4'-Hydroxy-2,4-dimethoxychalcone/ 98.31% (existing batch purity), 4'–Hydroxy–2,4–dimethoxychalcone, 4'-Hydroxy-2,dimethoxychalcone, 4'-Hydroxy-2,4-dimethoxychalcone, 98.31% ,, 98.31% ,. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 10 mg, 5 mg.
(E)-3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (CAS 151135-64-7) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (E)-3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: LNEYYODFMSUKGY-UXBLZVDNSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (E)-3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | LNEYYODFMSUKGY-UXBLZVDNSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)