CAS 82964-34-9 appears in our catalog under these names: 3',4'-Dimethoxy-2'-hydroxychalcone, 95%, 3',4'-Dimethoxy-2'-hydroxychalcone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2g.
(E)-1-(2-hydroxy-3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one (CAS 82964-34-9) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (E)-1-(2-hydroxy-3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one. InChIKey: DQPDCCTVAXUNSG-CSKARUKUSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (E)-1-(2-hydroxy-3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| InChIKey | DQPDCCTVAXUNSG-CSKARUKUSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)/C=C/C2=CC=CC=C2)O)OC |
Computed by PubChem (NCBI)