Products 728918-79-4
CAS 728918-79-4 appears in our catalog under these names: 3'-(Isopropoxycarbonyl)biphenyl-3-carboxylic acid, 95%, Biphenyl-3,3'-dicarboxylic acid 3-isopropyl ester, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-(3-propan-2-yloxycarbonylphenyl)benzoic acid (CAS 728918-79-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 3-(3-propan-2-yloxycarbonylphenyl)benzoic acid. InChIKey: YAKLXVIMPZGSIR-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 3-(3-propan-2-yloxycarbonylphenyl)benzoic acid |
| InChIKey | YAKLXVIMPZGSIR-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Biphenyl-3,3'-dicarboxylic acid 3-isopropyl ester, 3'-(Isopropoxycarbonyl)biphenyl-3-carboxylic acid, 3-(3-propan-2-yloxycarbonylphenyl)benzoic Acid, 3-(3-isopropoxycarbonylphenyl)benzoic acid, Biphenyl-3,3'-dicarboxylicacid3-isopropylester, 3'-{[(Propan-2-yl)oxy]carbonyl}[1,1'-biphenyl]-3-carboxylic acid