Products 1820647-75-3
CAS 1820647-75-3 is the registry number for methyl 4-[4-(2-methoxy-2-oxoethyl)phenyl]benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-[4-(2-methoxy-2-oxoethyl)phenyl]benzoate (CAS 1820647-75-3) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: methyl 4-[4-(2-methoxy-2-oxoethyl)phenyl]benzoate. InChIKey: QYEHNUPJUPQPCO-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | methyl 4-[4-(2-methoxy-2-oxoethyl)phenyl]benzoate |
| InChIKey | QYEHNUPJUPQPCO-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)