Products 1352318-71-8
CAS 1352318-71-8 is the registry number for 3-[4-(Ethoxycarbonyl)phenyl]phenylacetic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-[3-(4-ethoxycarbonylphenyl)phenyl]acetic acid (CAS 1352318-71-8) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 2-[3-(4-ethoxycarbonylphenyl)phenyl]acetic acid. InChIKey: UBNHYPLAFHZYCO-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 2-[3-(4-ethoxycarbonylphenyl)phenyl]acetic acid |
| InChIKey | UBNHYPLAFHZYCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)