cas: 39910-98-0 — see every product listed under this CAS number, including other names
4'-Morpholinoacetophenone 98% (CAS 39910-98-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A640860-1g |
| cas | 39910-98-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 375.94 Pln | |
| Ambeed | 100g | 1065.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A640860 |
1-(4-morpholin-4-ylphenyl)ethanone (CAS 39910-98-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-(4-morpholin-4-ylphenyl)ethanone. InChIKey: AKQWEDMTPCAESO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-(4-morpholin-4-ylphenyl)ethanone |
| InChIKey | AKQWEDMTPCAESO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2CCOCC2 |
Computed by PubChem (NCBI)