cas: 729-01-1 — see every product listed under this CAS number, including other names
4'-Nitro-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95% (CAS 729-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LUB-100mg |
| cas | 729-01-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1691.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4-nitrophenyl)benzoic acid (CAS 729-01-1) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 3-(4-nitrophenyl)benzoic acid. InChIKey: ZWQRSJSVYWEXHN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 3-(4-nitrophenyl)benzoic acid |
| InChIKey | ZWQRSJSVYWEXHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)