cas: 92-89-7 — see every product listed under this CAS number, including other names
4'-Nitrobiphenyl-4-carboxylic acid, 95% (CAS 92-89-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F080150-1G |
| cas | 92-89-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 549.82 Pln | |
| Fluorochem | 100g | 1658.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-nitrophenyl)benzoic acid (CAS 92-89-7) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(4-nitrophenyl)benzoic acid. InChIKey: LYINHPAEAYJDIR-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)benzoic acid |
| InChIKey | LYINHPAEAYJDIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)