cas: 728919-13-9 — see every product listed under this CAS number, including other names
4'-Trifluoromethoxy-biphenyl-2-carbaldehyde, 98+% (CAS 728919-13-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A280349-5g |
| cas | 728919-13-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14795.62 Pln | |
| AmBeed | 10g | 25120.48 Pln | |
| AmBeed | 25g | 49240.03 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[4-(trifluoromethoxy)phenyl]benzaldehyde (CAS 728919-13-9) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]benzaldehyde. InChIKey: GFDYSHSBKDFJJD-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]benzaldehyde |
| InChIKey | GFDYSHSBKDFJJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)