cas: 10600-83-6 — see every product listed under this CAS number, including other names
4,4'-(1,3,4-Oxadiazole-2,5-diyl)diphenol, 97% (CAS 10600-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695121-100MG |
| cas | 10600-83-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 456.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]phenol (CAS 10600-83-6) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 4-[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]phenol. InChIKey: BINSWEOIXQQWJW-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 4-[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]phenol |
| InChIKey | BINSWEOIXQQWJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)