cas: 964-68-1 — see every product listed under this CAS number, including other names
4,4'-Carbonyldibenzoic acid, 95% (CAS 964-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235885-250MG |
| cas | 964-68-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 25g | 659.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-carboxybenzoyl)benzoic acid (CAS 964-68-1) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 4-(4-carboxybenzoyl)benzoic acid. InChIKey: LFEWXDOYPCWFHR-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 4-(4-carboxybenzoyl)benzoic acid |
| InChIKey | LFEWXDOYPCWFHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)