CAS 3885-88-9 appears in our catalog under these names: 4-Benzoylphthalic acid, 95%, 4-Benzoylphthalic acid, 95+%, 4–Benzoylphthalic Acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
4-benzoylphthalic acid (CAS 3885-88-9) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 4-benzoylphthalic acid. InChIKey: ZZVNHEZUTFXFHU-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 4-benzoylphthalic acid |
| InChIKey | ZZVNHEZUTFXFHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)