Products 63196-11-2
CAS 63196-11-2 appears in our catalog under these names: 5-(4-Methoxyphenoxy)isobenzofuran-1,3-dione, 95%, 5–(4–Methoxyphenoxy)isobenzofuran–1，3–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g.
5-(4-methoxyphenoxy)-2-benzofuran-1,3-dione (CAS 63196-11-2) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 5-(4-methoxyphenoxy)-2-benzofuran-1,3-dione. InChIKey: CPNKLRCSVDVGQD-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 5-(4-methoxyphenoxy)-2-benzofuran-1,3-dione |
| InChIKey | CPNKLRCSVDVGQD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC3=C(C=C2)C(=O)OC3=O |
Computed by PubChem (NCBI)