Products 964-68-1
CAS 964-68-1 appears in our catalog under these names: Benzophenone-4,4'-dicarboxylic acid, 95%, Benzophenone–4,4'–dicarboxylic Acid, Benzophenone-4,4'-dicarboxylic acid, Benzophenone-4,4'-dicarboxylic Acid, >95.0%(HPLC)(T), 4,4'-Carbonyldibenzoic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 100g, 2g, 10g, 250mg.
4-(4-carboxybenzoyl)benzoic acid (CAS 964-68-1) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 4-(4-carboxybenzoyl)benzoic acid. InChIKey: LFEWXDOYPCWFHR-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 4-(4-carboxybenzoyl)benzoic acid |
| InChIKey | LFEWXDOYPCWFHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzophenone-4,4'-dicarboxylic acid, 4,4'-Carbonyldibenzoic Acid, 4-(4-carboxybenzoyl)benzoic acid, Oprea1_430654, Benzoic acid, 4,4'-carbonylbis-, Benzophenone-4,4'-dicarboxylicacid, 4,4 inverted exclamation mark -Carbonyldibenzoic Acid, 4,4-Carbonyldibenzoic Acid, 4,4'-Dicarboxybenz, 4,4'-Dicarboxybenzophenone