CAS 19852-25-6 appears in our catalog under these names: 2-(3,4-Dihydroxyphenyl)-5-hydroxy-4h-chromen-4-one, 98%, 5,3',4'-Trihydroxyflavone (>85%), 5,3',4'-Trihydroxyflavone. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 200mg, 25mg, 50mg, 2g, 5g.
2-(3,4-dihydroxyphenyl)-5-hydroxychromen-4-one (CAS 19852-25-6) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5-hydroxychromen-4-one. InChIKey: KXPQYWKYYDYOCQ-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5-hydroxychromen-4-one |
| InChIKey | KXPQYWKYYDYOCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)