CAS 85-58-5 appears in our catalog under these names: Benzophenone-2,4'-dicarboxylic acid, 95%, Benzophenone-2,4'-dicarboxylic acid monohydrate, 98%, 2-(4-Carboxybenzoyl)benzoic acid, 97%, Benzophenone–2,4'–dicarboxylic acid monohydrate, Benzophenone-2,4'-dicarboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 100g, 5g, 50g, 250g, 250mg.
2-(4-carboxybenzoyl)benzoic acid (CAS 85-58-5) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 2-(4-carboxybenzoyl)benzoic acid. InChIKey: RWHRIIMYBNGFEV-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 2-(4-carboxybenzoyl)benzoic acid |
| InChIKey | RWHRIIMYBNGFEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)