4,4'-Di(1H-imidazol-1-yl)-1,1'-biphenyl, 98%
cas: 855766-92-6 — see every product listed under this CAS number, including other names
4,4'-Di(1H-imidazol-1-yl)-1,1'-biphenyl, 98% (CAS 855766-92-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A506472-250mg |
| cas | 855766-92-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 576.19 Pln | |
| Ambeed | 25g | 1927.88 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 619.81 Pln | |
| BLDpharm | 25g | 2074.85 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 591.48 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-[4-(4-imidazol-1-ylphenyl)phenyl]imidazole (CAS 855766-92-6) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 1-[4-(4-imidazol-1-ylphenyl)phenyl]imidazole. InChIKey: MIFVIKFUGIBACJ-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 1-[4-(4-imidazol-1-ylphenyl)phenyl]imidazole |
| InChIKey | MIFVIKFUGIBACJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N3C=CN=C3)N4C=CN=C4 |
Computed by PubChem (NCBI)