Products 931998-17-3
CAS 931998-17-3 is the registry number for 3-{3-Phenylpyrazolo(1,5-a)pyrimidin-7-yl}aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)aniline (CAS 931998-17-3) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 3-(3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)aniline. InChIKey: IXAUDDRQKJVPCD-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 3-(3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)aniline |
| InChIKey | IXAUDDRQKJVPCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3N=CC=C(N3N=C2)C4=CC(=CC=C4)N |
Computed by PubChem (NCBI)