CAS 855766-92-6 appears in our catalog under these names: 4,4'–Di(1H–imidazol–1–yl)–1,1'–biphenyl, 4,4'-Di(1H-imidazol-1-yl)-1,1'-biphenyl, >98.0%(HPLC)(N), 4,4'-di(1H-iMidazol-1-yl)-1,1'-biphenyl, 98%, 98%, 4,4'-Di(1H-imidazol-1-yl)-1,1'-biphenyl, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
1-[4-(4-imidazol-1-ylphenyl)phenyl]imidazole (CAS 855766-92-6) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 1-[4-(4-imidazol-1-ylphenyl)phenyl]imidazole. InChIKey: MIFVIKFUGIBACJ-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 1-[4-(4-imidazol-1-ylphenyl)phenyl]imidazole |
| InChIKey | MIFVIKFUGIBACJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N3C=CN=C3)N4C=CN=C4 |
Computed by PubChem (NCBI)