CAS 162039-67-0 is the registry number for Tetraazapentacene. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
5,7,12,14-tetrahydroquinoxalino[2,3-b]phenazine (CAS 162039-67-0) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 5,7,12,14-tetrahydroquinoxalino[2,3-b]phenazine. InChIKey: GPMMPLGEVWLCJN-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 5,7,12,14-tetrahydroquinoxalino[2,3-b]phenazine |
| InChIKey | GPMMPLGEVWLCJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=CC4=C(C=C3N2)NC5=CC=CC=C5N4 |
Computed by PubChem (NCBI)