cas: 54628-21-6 — see every product listed under this CAS number, including other names
4,4'-Diamino-2,2'-dimethylbibenzyl, >98.0%(T)(GC) (CAS 54628-21-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1658-5G |
| cas | 54628-21-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 2036.07 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(GC) |
4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline (CAS 54628-21-6) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline. InChIKey: ISESBQNCWCFFFR-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline |
| InChIKey | ISESBQNCWCFFFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)CCC2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)