CAS 2760266-92-8 is the registry number for rel-8-Methyl-3-((2R,5S)-5-methylpiperidin-2-yl)quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methyl-3-[(2R,5S)-5-methylpiperidin-2-yl]quinoline (CAS 2760266-92-8) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 8-methyl-3-[(2R,5S)-5-methylpiperidin-2-yl]quinoline. InChIKey: LJOLQSLIEFAKKY-XHDPSFHLSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 8-methyl-3-[(2R,5S)-5-methylpiperidin-2-yl]quinoline |
| InChIKey | LJOLQSLIEFAKKY-XHDPSFHLSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC3=CC=CC(=C3N=C2)C |
Computed by PubChem (NCBI)