4,4'-Oxybis(bromobenzene), 98%
cas: 2050-47-7 — see every product listed under this CAS number, including other names
4,4'-Oxybis(bromobenzene), 98% (CAS 2050-47-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A190801-5g |
| cas | 2050-47-7 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 153.44 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 1021.19 Pln | |
| Ambeed | 1kg | 1532.94 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 153.30 Pln | |
| BLDpharm | 100g | 292.14 Pln | |
| BLDpharm | 500g | 1036.33 Pln | |
| BLDpharm | 1kg | 1647.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-4-(4-bromophenoxy)benzene (CAS 2050-47-7) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 1-bromo-4-(4-bromophenoxy)benzene. InChIKey: YAWIAFUBXXPJMQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O |
|---|---|
| Molecular weight | 328.00 g/mol |
| IUPAC name | 1-bromo-4-(4-bromophenoxy)benzene |
| InChIKey | YAWIAFUBXXPJMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
Bis(4-bromophenyl) ether, 4,4'-Dibromodiphenyl ether, Benzene, 1,1'-oxybis[4-bromo-, p,p'-Dibromodiphenyl ether, Ether, bis(p-bromophenyl), Bis(p-bromophenyl) ether, Benzene, 1,1'-oxybis(4-bromo-, di(4-bromophenyl) ether, 4-06-00-01048 (Beilstein Handbook Reference), Ether, bis(p-bromophenyl) (8CI)