CAS 46438-88-4 appears in our catalog under these names: 1,3–Dibromo–5–phenoxybenzene, 1,3-Dibromo-5-phenoxybenzene 98%, 1,3-Dibromo-5-phenoxybenzene, 98%, 98%, 1,3-Dibromo-5-phenoxybenzene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
1,3-dibromo-5-phenoxybenzene (CAS 46438-88-4) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 1,3-dibromo-5-phenoxybenzene. InChIKey: FOXBZJLXVUHYQZ-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O |
|---|---|
| Molecular weight | 328.00 g/mol |
| IUPAC name | 1,3-dibromo-5-phenoxybenzene |
| InChIKey | FOXBZJLXVUHYQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)