Products 171977-44-9

CAS 171977-44-9 appears in our catalog under these names: PBDE 7, PBDE No. 7. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10mg, 1mg, 50mg, 5mg.

Structural formula: {0} (CAS {1})

2,4-dibromo-1-phenoxybenzene (CAS 171977-44-9) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 2,4-dibromo-1-phenoxybenzene. InChIKey: JMCIHKKTRDLVCO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Br2O
Molecular weight328.00 g/mol
IUPAC name2,4-dibromo-1-phenoxybenzene
InChIKeyJMCIHKKTRDLVCO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=C(C=C(C=C2)Br)Br

Computed by PubChem (NCBI)