CAS 171977-44-9 appears in our catalog under these names: PBDE 7, PBDE No. 7. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10mg, 1mg, 50mg, 5mg.
2,4-dibromo-1-phenoxybenzene (CAS 171977-44-9) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 2,4-dibromo-1-phenoxybenzene. InChIKey: JMCIHKKTRDLVCO-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O |
|---|---|
| Molecular weight | 328.00 g/mol |
| IUPAC name | 2,4-dibromo-1-phenoxybenzene |
| InChIKey | JMCIHKKTRDLVCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)