Products 59452-49-2

CAS 59452-49-2 is the registry number for 3,4'-Dibromo-[1,1'-biphenyl]-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-bromo-4-(4-bromophenyl)phenol (CAS 59452-49-2) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 2-bromo-4-(4-bromophenyl)phenol. InChIKey: IJJCARCIQRHVIS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Br2O
Molecular weight328.00 g/mol
IUPAC name2-bromo-4-(4-bromophenyl)phenol
InChIKeyIJJCARCIQRHVIS-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=C(C=C2)O)Br)Br

Computed by PubChem (NCBI)