CAS 59452-49-2 is the registry number for 3,4'-Dibromo-[1,1'-biphenyl]-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-4-(4-bromophenyl)phenol (CAS 59452-49-2) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 2-bromo-4-(4-bromophenyl)phenol. InChIKey: IJJCARCIQRHVIS-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O |
|---|---|
| Molecular weight | 328.00 g/mol |
| IUPAC name | 2-bromo-4-(4-bromophenyl)phenol |
| InChIKey | IJJCARCIQRHVIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)O)Br)Br |
Computed by PubChem (NCBI)