Products 4400-05-9
CAS 4400-05-9 is the registry number for 3,5-Dibromo-[1,1'-biphenyl]-4-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,6-dibromo-4-phenylphenol (CAS 4400-05-9) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 2,6-dibromo-4-phenylphenol. InChIKey: SKQRVOXIIAXXEM-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O |
|---|---|
| Molecular weight | 328.00 g/mol |
| IUPAC name | 2,6-dibromo-4-phenylphenol |
| InChIKey | SKQRVOXIIAXXEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)Br)O)Br |
Computed by PubChem (NCBI)
Synonyms:
3,5-dibromobiphenyl-4-ol, 3,5-Dibromo-[1,1'-biphenyl]-4-ol, 2,6-dibromo-4-phenylphenol, 3,5-Dibromo-biphenyl-4-ol, (1,1'-Biphenyl)-4-ol, 3,5-dibromo-, [1,1'-Biphenyl]-4-ol, 3,5-dibromo-, 3,5-dibromo-(1,1'-biphenyl)-4-ol, 3,5-Dibromo-4-hydroxybiphenyl, cid_243556, 2,6-bis(bromanyl)-4-phenyl-phenol