CAS 2050-47-7 appears in our catalog under these names: PBDE 15, >95% (HPLC), PBDE 15 50 µg/mL in Nonane, PBDE No. 15, PBDE No. 15 100 µg/mL in Methanol, Bis(4–bromophenyl) ether. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 1ml, 250mg, 100g, 500g, 1x250mg.
1-bromo-4-(4-bromophenoxy)benzene (CAS 2050-47-7) is a chemical compound with the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. IUPAC name: 1-bromo-4-(4-bromophenoxy)benzene. InChIKey: YAWIAFUBXXPJMQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O |
|---|---|
| Molecular weight | 328.00 g/mol |
| IUPAC name | 1-bromo-4-(4-bromophenoxy)benzene |
| InChIKey | YAWIAFUBXXPJMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)