cas: 864776-02-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-methyl-3-furanyl)-1,3,2-dioxaborolane, 95% (CAS 864776-02-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225294-1G |
| cas | 864776-02-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2715.73 Pln | |
| Fluorochem | 5g | 7963.88 Pln | |
| Fluorochem | 10g | 14508.45 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane (CAS 864776-02-3) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane. InChIKey: JMLBPHNESOKSEV-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane |
| InChIKey | JMLBPHNESOKSEV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(OC=C2)C |
Computed by PubChem (NCBI)