cas: 356570-52-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-methylbenzyl)-1,3,2-dioxaborolane 95% (CAS 356570-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A236496-250mg |
| cas | 356570-52-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 943.31 Pln | |
| Ambeed | 10g | 1588.56 Pln | |
| Ambeed | 25g | 3390.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A236496 |
4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane (CAS 356570-52-0) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane. InChIKey: IRKUSKILEFQOJQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane |
| InChIKey | IRKUSKILEFQOJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)