Products 214360-78-8
CAS 214360-78-8 appears in our catalog under these names: 2,4,6-Trimethylphenylboronic acid neopentyl glycol ester, 98%, 2-Mesityl-5,5-dimethyl-1,3,2-dioxaborinane, 95-<97%, 2-Mesityl-5,5-dimethyl-1,3,2-dioxaborinane, ≥97-<99%, 2，4，6–Trimethylbenzeneboronic acid neopentyl glycol cyclic ester, 2-Mesityl-5,5-dimethyl-1,3,2-dioxaborinane 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 50g, 100g, 200g, 300g, 400g, 500g.
5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane (CAS 214360-78-8) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane. InChIKey: ITLDRNGUSKUMRG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | ITLDRNGUSKUMRG-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)