CAS 169126-63-0 appears in our catalog under these names: 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalene-2-boronic acid, 98%, 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalene-2-boronic , (5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 98%, 98%, (5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 100g.
(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)boronic acid (CAS 169126-63-0) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: (5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)boronic acid. InChIKey: NXBNRLONOXGRCQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | (5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)boronic acid |
| InChIKey | NXBNRLONOXGRCQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(CCC2(C)C)(C)C)(O)O |
Computed by PubChem (NCBI)